C29H38N2O3 — CID 122376206
4-[4-[5-(4-decoxyphenyl)-1,2-oxazol-3-yl]phenyl]morpholine (PubChem CID 122376206) has the molecular formula C29H38N2O3 and a molecular weight of 462.63 g/mol. Its IUPAC name is 4-[4-[5-(4-decoxyphenyl)-1,2-oxazol-3-yl]phenyl]morpholine.
| Compound Name | 4-[4-[5-(4-decoxyphenyl)-1,2-oxazol-3-yl]phenyl]morpholine |
|---|---|
| PubChem CID | 122376206 |
| Molecular Formula | C29H38N2O3 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | 4-[4-[5-(4-decoxyphenyl)-1,2-oxazol-3-yl]phenyl]morpholine |
| SMILES | CCCCCCCCCCOc1ccc(-c2cc(-c3ccc(N4CCOCC4)cc3)no2)cc1 |
| InChI | InChI=1S/C29H38N2O3/c1-2-3-4-5-6-7-8-9-20-33-27-16-12-25(13-17-27)29-23-28(30-34-29)24-10-14-26(15-11-24)31-18-21-32-22-19-31/h10-17,23H,2-9,18-22H2,1H3 |
| InChIKey | LZJYBDOCRCQVSD-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 47.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|