C11H10F6O — CID 141301748
1-fluoro-3-(4,4,5,5,5-pentafluoropentoxy)benzene (PubChem CID 141301748) has the molecular formula C11H10F6O and a molecular weight of 272.19 g/mol. Its IUPAC name is 1-fluoro-3-(4,4,5,5,5-pentafluoropentoxy)benzene.
| Compound Name | 1-fluoro-3-(4,4,5,5,5-pentafluoropentoxy)benzene |
|---|---|
| PubChem CID | 141301748 |
| Molecular Formula | C11H10F6O |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 1-fluoro-3-(4,4,5,5,5-pentafluoropentoxy)benzene |
| SMILES | Fc1cccc(OCCCC(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C11H10F6O/c12-8-3-1-4-9(7-8)18-6-2-5-10(13,14)11(15,16)17/h1,3-4,7H,2,5-6H2 |
| InChIKey | SJXJMBIJKZZIHT-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|