C16H26FNO2 — CID 64804186
6-(3-fluorophenoxy)-2-methyl-2-(propan-2-ylamino)hexan-1-ol (PubChem CID 64804186) has the molecular formula C16H26FNO2 and a molecular weight of 283.39 g/mol. Its IUPAC name is 6-(3-fluorophenoxy)-2-methyl-2-(propan-2-ylamino)hexan-1-ol.
| Compound Name | 6-(3-fluorophenoxy)-2-methyl-2-(propan-2-ylamino)hexan-1-ol |
|---|---|
| PubChem CID | 64804186 |
| Molecular Formula | C16H26FNO2 |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 6-(3-fluorophenoxy)-2-methyl-2-(propan-2-ylamino)hexan-1-ol |
| SMILES | CC(C)NC(C)(CO)CCCCOc1cccc(F)c1 |
| InChI | InChI=1S/C16H26FNO2/c1-13(2)18-16(3,12-19)9-4-5-10-20-15-8-6-7-14(17)11-15/h6-8,11,13,18-19H,4-5,9-10,12H2,1-3H3 |
| InChIKey | PLGRWROANWFANP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|