C15H25FN2O — CID 64827300
3-(N-ethyl-3-fluoroanilino)-2-methyl-2-(propan-2-ylamino)propan-1-ol (PubChem CID 64827300) has the molecular formula C15H25FN2O and a molecular weight of 268.38 g/mol. Its IUPAC name is 3-(N-ethyl-3-fluoroanilino)-2-methyl-2-(propan-2-ylamino)propan-1-ol.
| Compound Name | 3-(N-ethyl-3-fluoroanilino)-2-methyl-2-(propan-2-ylamino)propan-1-ol |
|---|---|
| PubChem CID | 64827300 |
| Molecular Formula | C15H25FN2O |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 3-(N-ethyl-3-fluoroanilino)-2-methyl-2-(propan-2-ylamino)propan-1-ol |
| SMILES | CCN(CC(C)(CO)NC(C)C)c1cccc(F)c1 |
| InChI | InChI=1S/C15H25FN2O/c1-5-18(14-8-6-7-13(16)9-14)10-15(4,11-19)17-12(2)3/h6-9,12,17,19H,5,10-11H2,1-4H3 |
| InChIKey | KTTMBJYYBRZBOB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |