C14H23NO — CID 62272248
3-(N-ethyl-3-methylanilino)-2,2-dimethylpropan-1-ol (PubChem CID 62272248) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 3-(N-ethyl-3-methylanilino)-2,2-dimethylpropan-1-ol.
| Compound Name | 3-(N-ethyl-3-methylanilino)-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 62272248 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 3-(N-ethyl-3-methylanilino)-2,2-dimethylpropan-1-ol |
| SMILES | CCN(CC(C)(C)CO)c1cccc(C)c1 |
| InChI | InChI=1S/C14H23NO/c1-5-15(10-14(3,4)11-16)13-8-6-7-12(2)9-13/h6-9,16H,5,10-11H2,1-4H3 |
| InChIKey | SWHUHKVXMBXIAB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |