C14H20FNO2 — CID 79621537
methyl 3-(N-ethyl-3-fluoroanilino)-2,2-dimethylpropanoate (PubChem CID 79621537) has the molecular formula C14H20FNO2 and a molecular weight of 253.32 g/mol. Its IUPAC name is methyl 3-(N-ethyl-3-fluoroanilino)-2,2-dimethylpropanoate.
| Compound Name | methyl 3-(N-ethyl-3-fluoroanilino)-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 79621537 |
| Molecular Formula | C14H20FNO2 |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | methyl 3-(N-ethyl-3-fluoroanilino)-2,2-dimethylpropanoate |
| SMILES | CCN(CC(C)(C)C(=O)OC)c1cccc(F)c1 |
| InChI | InChI=1S/C14H20FNO2/c1-5-16(10-14(2,3)13(17)18-4)12-8-6-7-11(15)9-12/h6-9H,5,10H2,1-4H3 |
| InChIKey | XOYOFLUHZPJSJD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |