About 3-(N-ethylanilino)-2,2-dimethylpropanoyl chloride
3-(N-ethylanilino)-2,2-dimethylpropanoyl chloride (PubChem CID 82041541) has the molecular formula C13H18ClNO
and a molecular weight of 239.75 g/mol. Its IUPAC name is 3-(N-ethylanilino)-2,2-dimethylpropanoyl chloride.
Molecular Properties
| Compound Name | 3-(N-ethylanilino)-2,2-dimethylpropanoyl chloride |
| PubChem CID | 82041541 |
| Molecular Formula | C13H18ClNO |
| Molecular Weight | 239.75 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 3-(N-ethylanilino)-2,2-dimethylpropanoyl chloride |
| SMILES | CCN(CC(C)(C)C(=O)Cl)c1ccccc1 |
| InChI | InChI=1S/C13H18ClNO/c1-4-15(10-13(2,3)12(14)16)11-8-6-5-7-9-11/h5-9H,4,10H2,1-3H3 |
| InChIKey | MNXRXEFRONAURD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.75 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(N-ethylanilino)-2,2-dimethylpropanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(N-ethylanilino)-2,2-dimethylpropanoyl chloride?
The IUPAC name of 3-(N-ethylanilino)-2,2-dimethylpropanoyl chloride (CID 82041541) is 3-(N-ethylanilino)-2,2-dimethylpropanoyl chloride.
What is the SMILES notation for 3-(N-ethylanilino)-2,2-dimethylpropanoyl chloride?
The canonical SMILES for 3-(N-ethylanilino)-2,2-dimethylpropanoyl chloride is CCN(CC(C)(C)C(=O)Cl)c1ccccc1.
What is the InChIKey of 3-(N-ethylanilino)-2,2-dimethylpropanoyl chloride?
The InChIKey is MNXRXEFRONAURD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18ClNO/c1-4-15(10-13(2,3)12(14)16)11-8-6-5-7-9-11/h5-9H,4,10H2,1-3H3.
What are the key properties of 3-(N-ethylanilino)-2,2-dimethylpropanoyl chloride?
3-(N-ethylanilino)-2,2-dimethylpropanoyl chloride has a molecular weight of 239.75 g/mol, XLogP of 3.30, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(N-ethylanilino)-2,2-dimethylpropanoyl chloride is sourced from PubChem (CID 82041541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).