About Butylacetanilide
Butylacetanilide (PubChem CID 7051) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is N-butyl-N-phenylacetamide.
Molecular Properties
| Compound Name | Butylacetanilide |
| PubChem CID | 7051 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | N-butyl-N-phenylacetamide |
| SMILES | CCCCN(C1=CC=CC=C1)C(=O)C |
| InChI | InChI=1S/C12H17NO/c1-3-4-10-13(11(2)14)12-8-6-5-7-9-12/h5-9H,3-4,10H2,1-2H3 |
| InChIKey | ZWDZJRRQSXLOQR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 20.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | 173 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze Butylacetanilide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Butylacetanilide?
The IUPAC name of Butylacetanilide (CID 7051) is N-butyl-N-phenylacetamide.
What is the SMILES notation for Butylacetanilide?
The canonical SMILES for Butylacetanilide is CCCCN(C1=CC=CC=C1)C(=O)C.
What is the InChIKey of Butylacetanilide?
The InChIKey is ZWDZJRRQSXLOQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO/c1-3-4-10-13(11(2)14)12-8-6-5-7-9-12/h5-9H,3-4,10H2,1-2H3.
What are the key properties of Butylacetanilide?
Butylacetanilide has a molecular weight of 191.27 g/mol, XLogP of 2.50, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Butylacetanilide is sourced from PubChem (CID 7051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).