About N-phenylpropanamide
N-phenylpropanamide (PubChem CID 12107) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is N-phenylpropanamide.
Molecular Properties
| Compound Name | N-phenylpropanamide |
| PubChem CID | 12107 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | N-phenylpropanamide |
| SMILES | CCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C9H11NO/c1-2-9(11)10-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11) |
| InChIKey | ZTHRQJQJODGZHV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-phenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenylpropanamide?
The IUPAC name of N-phenylpropanamide (CID 12107) is N-phenylpropanamide.
What is the SMILES notation for N-phenylpropanamide?
The canonical SMILES for N-phenylpropanamide is CCC(=O)Nc1ccccc1.
What is the InChIKey of N-phenylpropanamide?
The InChIKey is ZTHRQJQJODGZHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO/c1-2-9(11)10-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11).
What are the key properties of N-phenylpropanamide?
N-phenylpropanamide has a molecular weight of 149.19 g/mol, XLogP of 2.04, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenylpropanamide is sourced from PubChem (CID 12107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).