C17H29FN2O — CID 64828310
5-(N-ethyl-3-fluoroanilino)-2-methyl-2-(propylamino)pentan-1-ol (PubChem CID 64828310) has the molecular formula C17H29FN2O and a molecular weight of 296.43 g/mol. Its IUPAC name is 5-(N-ethyl-3-fluoroanilino)-2-methyl-2-(propylamino)pentan-1-ol.
| Compound Name | 5-(N-ethyl-3-fluoroanilino)-2-methyl-2-(propylamino)pentan-1-ol |
|---|---|
| PubChem CID | 64828310 |
| Molecular Formula | C17H29FN2O |
| Molecular Weight | 296.43 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | 5-(N-ethyl-3-fluoroanilino)-2-methyl-2-(propylamino)pentan-1-ol |
| SMILES | CCCNC(C)(CO)CCCN(CC)c1cccc(F)c1 |
| InChI | InChI=1S/C17H29FN2O/c1-4-11-19-17(3,14-21)10-7-12-20(5-2)16-9-6-8-15(18)13-16/h6,8-9,13,19,21H,4-5,7,10-12,14H2,1-3H3 |
| InChIKey | NDFJPYWNELFDGG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |