C17H29FN2O — CID 64790530
5-(N-ethyl-4-fluoroanilino)-2-methyl-2-(propan-2-ylamino)pentan-1-ol (PubChem CID 64790530) has the molecular formula C17H29FN2O and a molecular weight of 296.43 g/mol. Its IUPAC name is 5-(N-ethyl-4-fluoroanilino)-2-methyl-2-(propan-2-ylamino)pentan-1-ol.
| Compound Name | 5-(N-ethyl-4-fluoroanilino)-2-methyl-2-(propan-2-ylamino)pentan-1-ol |
|---|---|
| PubChem CID | 64790530 |
| Molecular Formula | C17H29FN2O |
| Molecular Weight | 296.43 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | 5-(N-ethyl-4-fluoroanilino)-2-methyl-2-(propan-2-ylamino)pentan-1-ol |
| SMILES | CCN(CCCC(C)(CO)NC(C)C)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H29FN2O/c1-5-20(16-9-7-15(18)8-10-16)12-6-11-17(4,13-21)19-14(2)3/h7-10,14,19,21H,5-6,11-13H2,1-4H3 |
| InChIKey | DJURXSKGFXYHDN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |