C17H27FN2O — CID 64789739
2-(cyclopropylamino)-5-(N-ethyl-4-fluoroanilino)-2-methylpentan-1-ol (PubChem CID 64789739) has the molecular formula C17H27FN2O and a molecular weight of 294.41 g/mol. Its IUPAC name is 2-(cyclopropylamino)-5-(N-ethyl-4-fluoroanilino)-2-methylpentan-1-ol.
| Compound Name | 2-(cyclopropylamino)-5-(N-ethyl-4-fluoroanilino)-2-methylpentan-1-ol |
|---|---|
| PubChem CID | 64789739 |
| Molecular Formula | C17H27FN2O |
| Molecular Weight | 294.41 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 2-(cyclopropylamino)-5-(N-ethyl-4-fluoroanilino)-2-methylpentan-1-ol |
| SMILES | CCN(CCCC(C)(CO)NC1CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H27FN2O/c1-3-20(16-9-5-14(18)6-10-16)12-4-11-17(2,13-21)19-15-7-8-15/h5-6,9-10,15,19,21H,3-4,7-8,11-13H2,1-2H3 |
| InChIKey | VXEASLGUZLTVKX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |