C14H17F3N2O2 — CID 103864877
4-[3-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]propoxy]benzonitrile (PubChem CID 103864877) has the molecular formula C14H17F3N2O2 and a molecular weight of 302.30 g/mol. Its IUPAC name is 4-[3-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]propoxy]benzonitrile.
| Compound Name | 4-[3-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]propoxy]benzonitrile |
|---|---|
| PubChem CID | 103864877 |
| Molecular Formula | C14H17F3N2O2 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 4-[3-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]propoxy]benzonitrile |
| SMILES | N#Cc1ccc(OCCCN(CCO)CC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H17F3N2O2/c15-14(16,17)11-19(7-8-20)6-1-9-21-13-4-2-12(10-18)3-5-13/h2-5,20H,1,6-9,11H2 |
| InChIKey | VRAIZBWGUWBSNE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 56.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|