C31H49N3O3 — CID 70074611
1-[4-[3-(diethylamino)propoxy]phenyl]ethanol;4-[3-(dipropylamino)propoxy]benzonitrile (PubChem CID 70074611) has the molecular formula C31H49N3O3 and a molecular weight of 511.75 g/mol. Its IUPAC name is 1-[4-[3-(diethylamino)propoxy]phenyl]ethanol;4-[3-(dipropylamino)propoxy]benzonitrile.
| Compound Name | 1-[4-[3-(diethylamino)propoxy]phenyl]ethanol;4-[3-(dipropylamino)propoxy]benzonitrile |
|---|---|
| PubChem CID | 70074611 |
| Molecular Formula | C31H49N3O3 |
| Molecular Weight | 511.75 g/mol |
| Exact Mass | 511.38 |
| IUPAC Name | 1-[4-[3-(diethylamino)propoxy]phenyl]ethanol;4-[3-(dipropylamino)propoxy]benzonitrile |
| SMILES | CCCN(CCC)CCCOc1ccc(C#N)cc1.CCN(CC)CCCOc1ccc(C(C)O)cc1 |
| InChI | InChI=1S/C16H24N2O.C15H25NO2/c1-3-10-18(11-4-2)12-5-13-19-16-8-6-15(14-17)7-9-16;1-4-16(5-2)11-6-12-18-15-9-7-14(8-10-15)13(3)17/h6-9H,3-5,10-13H2,1-2H3;7-10,13,17H,4-6,11-12H2,1-3H3 |
| InChIKey | AYWPLNGNLSGVBI-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.75 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|