C13H18N2O2 — CID 113339720
4-[2-[1-hydroxypropan-2-yl(methyl)amino]ethoxy]benzonitrile (PubChem CID 113339720) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 4-[2-[1-hydroxypropan-2-yl(methyl)amino]ethoxy]benzonitrile.
| Compound Name | 4-[2-[1-hydroxypropan-2-yl(methyl)amino]ethoxy]benzonitrile |
|---|---|
| PubChem CID | 113339720 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 4-[2-[1-hydroxypropan-2-yl(methyl)amino]ethoxy]benzonitrile |
| SMILES | CC(CO)N(C)CCOc1ccc(C#N)cc1 |
| InChI | InChI=1S/C13H18N2O2/c1-11(10-16)15(2)7-8-17-13-5-3-12(9-14)4-6-13/h3-6,11,16H,7-8,10H2,1-2H3 |
| InChIKey | UVGSEWQRIBOGSS-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 56.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |