C16H23N3O2 — CID 60696515
2-[2-(4-cyanophenoxy)ethyl-methylamino]-N,N-diethylacetamide (PubChem CID 60696515) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 2-[2-(4-cyanophenoxy)ethyl-methylamino]-N,N-diethylacetamide.
| Compound Name | 2-[2-(4-cyanophenoxy)ethyl-methylamino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 60696515 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 2-[2-(4-cyanophenoxy)ethyl-methylamino]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN(C)CCOc1ccc(C#N)cc1 |
| InChI | InChI=1S/C16H23N3O2/c1-4-19(5-2)16(20)13-18(3)10-11-21-15-8-6-14(12-17)7-9-15/h6-9H,4-5,10-11,13H2,1-3H3 |
| InChIKey | AENCQACASFPYKL-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |