C25H17Cl2F10NO2 — CID 11556350
(2R)-3-[3-(2,3-dichlorophenoxy)-N-[[2-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]methyl]anilino]-1,1,1-trifluoropropan-2-ol (PubChem CID 11556350) has the molecular formula C25H17Cl2F10NO2 and a molecular weight of 624.30 g/mol. Its IUPAC name is (2R)-3-[3-(2,3-dichlorophenoxy)-N-[[2-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]methyl]anilino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | (2R)-3-[3-(2,3-dichlorophenoxy)-N-[[2-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]methyl]anilino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 11556350 |
| Molecular Formula | C25H17Cl2F10NO2 |
| Molecular Weight | 624.30 g/mol |
| Exact Mass | 623.05 |
| IUPAC Name | (2R)-3-[3-(2,3-dichlorophenoxy)-N-[[2-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]methyl]anilino]-1,1,1-trifluoropropan-2-ol |
| SMILES | O[C@H](CN(Cc1ccccc1C(F)(F)C(F)(F)C(F)(F)F)c1cccc(Oc2cccc(Cl)c2Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C25H17Cl2F10NO2/c26-18-9-4-10-19(21(18)27)40-16-7-3-6-15(11-16)38(13-20(39)23(30,31)32)12-14-5-1-2-8-17(14)22(28,29)24(33,34)25(35,36)37/h1-11,20,39H,12-13H2/t20-/m1/s1 |
| InChIKey | NWRAMWUACSERFB-HXUWFJFHSA-N |
| XLogP | 9.00 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.30 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|