C25H24F7N3O3 — CID 87448648
3-[[4-(3-ethyl-5-methylphenoxy)pyrimidin-2-yl]-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]amino]-1,1,1-trifluoropropan-2-ol (PubChem CID 87448648) has the molecular formula C25H24F7N3O3 and a molecular weight of 547.47 g/mol. Its IUPAC name is 3-[[4-(3-ethyl-5-methylphenoxy)pyrimidin-2-yl]-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]amino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[[4-(3-ethyl-5-methylphenoxy)pyrimidin-2-yl]-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]amino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 87448648 |
| Molecular Formula | C25H24F7N3O3 |
| Molecular Weight | 547.47 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | 3-[[4-(3-ethyl-5-methylphenoxy)pyrimidin-2-yl]-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]amino]-1,1,1-trifluoropropan-2-ol |
| SMILES | CCc1cc(C)cc(Oc2ccnc(N(Cc3cccc(OC(F)(F)C(F)F)c3)CC(O)C(F)(F)F)n2)c1 |
| InChI | InChI=1S/C25H24F7N3O3/c1-3-16-9-15(2)10-19(11-16)37-21-7-8-33-23(34-21)35(14-20(36)24(28,29)30)13-17-5-4-6-18(12-17)38-25(31,32)22(26)27/h4-12,20,22,36H,3,13-14H2,1-2H3 |
| InChIKey | HJGWFUJHHVUBQX-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.47 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|