C24H22F7N3O3 — CID 87443631
3-[[4-(2-ethylphenoxy)pyrimidin-2-yl]-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]amino]-1,1,1-trifluoropropan-2-ol (PubChem CID 87443631) has the molecular formula C24H22F7N3O3 and a molecular weight of 533.44 g/mol. Its IUPAC name is 3-[[4-(2-ethylphenoxy)pyrimidin-2-yl]-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]amino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[[4-(2-ethylphenoxy)pyrimidin-2-yl]-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]amino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 87443631 |
| Molecular Formula | C24H22F7N3O3 |
| Molecular Weight | 533.44 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | 3-[[4-(2-ethylphenoxy)pyrimidin-2-yl]-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]amino]-1,1,1-trifluoropropan-2-ol |
| SMILES | CCc1ccccc1Oc1ccnc(N(Cc2cccc(OC(F)(F)C(F)F)c2)CC(O)C(F)(F)F)n1 |
| InChI | InChI=1S/C24H22F7N3O3/c1-2-16-7-3-4-9-18(16)36-20-10-11-32-22(33-20)34(14-19(35)23(27,28)29)13-15-6-5-8-17(12-15)37-24(30,31)21(25)26/h3-12,19,21,35H,2,13-14H2,1H3 |
| InChIKey | OPRJAQJGTRAZGG-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.44 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|