C20H32N2O4 — CID 29164290
(2R)-1-[[(2S)-3-butoxy-2-hydroxypropyl]-(2-hydroxyethyl)amino]-3-indol-1-ylpropan-2-ol (PubChem CID 29164290) has the molecular formula C20H32N2O4 and a molecular weight of 364.49 g/mol. Its IUPAC name is (2R)-1-[[(2S)-3-butoxy-2-hydroxypropyl]-(2-hydroxyethyl)amino]-3-indol-1-ylpropan-2-ol.
| Compound Name | (2R)-1-[[(2S)-3-butoxy-2-hydroxypropyl]-(2-hydroxyethyl)amino]-3-indol-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 29164290 |
| Molecular Formula | C20H32N2O4 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | (2R)-1-[[(2S)-3-butoxy-2-hydroxypropyl]-(2-hydroxyethyl)amino]-3-indol-1-ylpropan-2-ol |
| SMILES | CCCCOC[C@@H](O)CN(CCO)C[C@@H](O)Cn1ccc2ccccc21 |
| InChI | InChI=1S/C20H32N2O4/c1-2-3-12-26-16-19(25)14-21(10-11-23)13-18(24)15-22-9-8-17-6-4-5-7-20(17)22/h4-9,18-19,23-25H,2-3,10-16H2,1H3/t18-,19+/m1/s1 |
| InChIKey | SZGZECNJOSGQQZ-MOPGFXCFSA-N |
| XLogP | 1.47 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|