C22H21N3OS — CID 44574729
methyl N'-[4-(2-carbazol-9-ylethoxy)phenyl]carbamimidothioate (PubChem CID 44574729) has the molecular formula C22H21N3OS and a molecular weight of 375.50 g/mol. Its IUPAC name is methyl N'-[4-(2-carbazol-9-ylethoxy)phenyl]carbamimidothioate.
| Compound Name | methyl N'-[4-(2-carbazol-9-ylethoxy)phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 44574729 |
| Molecular Formula | C22H21N3OS |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | methyl N'-[4-(2-carbazol-9-ylethoxy)phenyl]carbamimidothioate |
| SMILES | CS/C(N)=N\c1ccc(OCCn2c3ccccc3c3ccccc32)cc1 |
| InChI | InChI=1S/C22H21N3OS/c1-27-22(23)24-16-10-12-17(13-11-16)26-15-14-25-20-8-4-2-6-18(20)19-7-3-5-9-21(19)25/h2-13H,14-15H2,1H3,(H2,23,24) |
| InChIKey | RDLXQWSXSUYJPA-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 52.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|