C23H26N2O4S — CID 59723890
2-methyl-2-[4-[3-(2-methyl-4-oxoquinazolin-3-yl)propoxy]phenyl]sulfanylbutanoic acid (PubChem CID 59723890) has the molecular formula C23H26N2O4S and a molecular weight of 426.54 g/mol. Its IUPAC name is 2-methyl-2-[4-[3-(2-methyl-4-oxoquinazolin-3-yl)propoxy]phenyl]sulfanylbutanoic acid.
| Compound Name | 2-methyl-2-[4-[3-(2-methyl-4-oxoquinazolin-3-yl)propoxy]phenyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 59723890 |
| Molecular Formula | C23H26N2O4S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 2-methyl-2-[4-[3-(2-methyl-4-oxoquinazolin-3-yl)propoxy]phenyl]sulfanylbutanoic acid |
| SMILES | CCC(C)(Sc1ccc(OCCCn2c(C)nc3ccccc3c2=O)cc1)C(=O)O |
| InChI | InChI=1S/C23H26N2O4S/c1-4-23(3,22(27)28)30-18-12-10-17(11-13-18)29-15-7-14-25-16(2)24-20-9-6-5-8-19(20)21(25)26/h5-6,8-13H,4,7,14-15H2,1-3H3,(H,27,28) |
| InChIKey | YGINFFRJCVEWKH-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|