C25H25NO4S — CID 142159585
2-ethoxy-2-[4-(2-phenothiazin-10-ylethoxy)phenyl]propanoic acid (PubChem CID 142159585) has the molecular formula C25H25NO4S and a molecular weight of 435.55 g/mol. Its IUPAC name is 2-ethoxy-2-[4-(2-phenothiazin-10-ylethoxy)phenyl]propanoic acid.
| Compound Name | 2-ethoxy-2-[4-(2-phenothiazin-10-ylethoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 142159585 |
| Molecular Formula | C25H25NO4S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 2-ethoxy-2-[4-(2-phenothiazin-10-ylethoxy)phenyl]propanoic acid |
| SMILES | CCOC(C)(C(=O)O)c1ccc(OCCN2c3ccccc3Sc3ccccc32)cc1 |
| InChI | InChI=1S/C25H25NO4S/c1-3-30-25(2,24(27)28)18-12-14-19(15-13-18)29-17-16-26-20-8-4-6-10-22(20)31-23-11-7-5-9-21(23)26/h4-15H,3,16-17H2,1-2H3,(H,27,28) |
| InChIKey | RWLQPDKQUWJXEX-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|