C31H39N3O6S — CID 59054845
(2S)-1-[(5-amino-5-carboxypentyl)azaniumyl]oxy-2-ethoxy-3-[4-(2-phenothiazin-10-ylethoxy)phenyl]propan-1-olate (PubChem CID 59054845) has the molecular formula C31H39N3O6S and a molecular weight of 581.74 g/mol. Its IUPAC name is (2S)-1-[(5-amino-5-carboxypentyl)azaniumyl]oxy-2-ethoxy-3-[4-(2-phenothiazin-10-ylethoxy)phenyl]propan-1-olate.
| Compound Name | (2S)-1-[(5-amino-5-carboxypentyl)azaniumyl]oxy-2-ethoxy-3-[4-(2-phenothiazin-10-ylethoxy)phenyl]propan-1-olate |
|---|---|
| PubChem CID | 59054845 |
| Molecular Formula | C31H39N3O6S |
| Molecular Weight | 581.74 g/mol |
| Exact Mass | 581.26 |
| IUPAC Name | (2S)-1-[(5-amino-5-carboxypentyl)azaniumyl]oxy-2-ethoxy-3-[4-(2-phenothiazin-10-ylethoxy)phenyl]propan-1-olate |
| SMILES | CCO[C@@H](Cc1ccc(OCCN2c3ccccc3Sc3ccccc32)cc1)C([O-])O[NH2+]CCCCC(N)C(=O)O |
| InChI | InChI=1S/C31H38N3O6S/c1-2-38-27(31(37)40-33-18-8-7-9-24(32)30(35)36)21-22-14-16-23(17-15-22)39-20-19-34-25-10-3-5-12-28(25)41-29-13-6-4-11-26(29)34/h3-6,10-17,24,27,31,33H,2,7-9,18-21,32H2,1H3,(H,35,36)/q-1/p+1/t24?,27-,31?/m0/s1 |
| InChIKey | JOJGYUMERDCLCF-FYKVLBHHSA-O |
| XLogP | 3.08 |
| TPSA | 133.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.74 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|