C26H37N5O7 — CID 10256494
2-amino-5-(diaminomethylideneamino)pentanoic acid;(2S)-3-[4-[2-(2,3-dihydro-1,4-benzoxazin-4-yl)ethoxy]phenyl]-2-methoxypropanoic acid (PubChem CID 10256494) has the molecular formula C26H37N5O7 and a molecular weight of 531.61 g/mol. Its IUPAC name is 2-amino-5-(diaminomethylideneamino)pentanoic acid;(2S)-3-[4-[2-(2,3-dihydro-1,4-benzoxazin-4-yl)ethoxy]phenyl]-2-methoxypropanoic acid.
| Compound Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;(2S)-3-[4-[2-(2,3-dihydro-1,4-benzoxazin-4-yl)ethoxy]phenyl]-2-methoxypropanoic acid |
|---|---|
| PubChem CID | 10256494 |
| Molecular Formula | C26H37N5O7 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;(2S)-3-[4-[2-(2,3-dihydro-1,4-benzoxazin-4-yl)ethoxy]phenyl]-2-methoxypropanoic acid |
| SMILES | CO[C@@H](Cc1ccc(OCCN2CCOc3ccccc32)cc1)C(=O)O.NC(N)=NCCCC(N)C(=O)O |
| InChI | InChI=1S/C20H23NO5.C6H14N4O2/c1-24-19(20(22)23)14-15-6-8-16(9-7-15)25-12-10-21-11-13-26-18-5-3-2-4-17(18)21;7-4(5(11)12)2-1-3-10-6(8)9/h2-9,19H,10-14H2,1H3,(H,22,23);4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t19-;/m0./s1 |
| InChIKey | MOIQQNWSZIPYCF-FYZYNONXSA-N |
| XLogP | 1.06 |
| TPSA | 195.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|