C23H21NO5 — CID 11223055
(2S)-2-hydroxy-3-[4-(2-phenoxazin-10-ylethoxy)phenyl]propanoic acid (PubChem CID 11223055) has the molecular formula C23H21NO5 and a molecular weight of 391.42 g/mol. Its IUPAC name is (2S)-2-hydroxy-3-[4-(2-phenoxazin-10-ylethoxy)phenyl]propanoic acid.
| Compound Name | (2S)-2-hydroxy-3-[4-(2-phenoxazin-10-ylethoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 11223055 |
| Molecular Formula | C23H21NO5 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | (2S)-2-hydroxy-3-[4-(2-phenoxazin-10-ylethoxy)phenyl]propanoic acid |
| SMILES | O=C(O)[C@@H](O)Cc1ccc(OCCN2c3ccccc3Oc3ccccc32)cc1 |
| InChI | InChI=1S/C23H21NO5/c25-20(23(26)27)15-16-9-11-17(12-10-16)28-14-13-24-18-5-1-3-7-21(18)29-22-8-4-2-6-19(22)24/h1-12,20,25H,13-15H2,(H,26,27)/t20-/m0/s1 |
| InChIKey | SBTIIPIFXJHMNB-FQEVSTJZSA-N |
| XLogP | 4.00 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_666_B(3)', 'substructure': 'N/A'} |
|---|