C32H41NO5S — CID 142223958
propan-2-yl 2-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-3-[4-(2-phenoxazin-10-ylethoxy)phenyl]propanoate (PubChem CID 142223958) has the molecular formula C32H41NO5S and a molecular weight of 551.75 g/mol. Its IUPAC name is propan-2-yl 2-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-3-[4-(2-phenoxazin-10-ylethoxy)phenyl]propanoate.
| Compound Name | propan-2-yl 2-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-3-[4-(2-phenoxazin-10-ylethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 142223958 |
| Molecular Formula | C32H41NO5S |
| Molecular Weight | 551.75 g/mol |
| Exact Mass | 551.27 |
| IUPAC Name | propan-2-yl 2-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-3-[4-(2-phenoxazin-10-ylethoxy)phenyl]propanoate |
| SMILES | CC(C)OC(=O)C(Cc1ccc(OCCN2c3ccccc3Oc3ccccc32)cc1)OS(C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H41NO5S/c1-23(2)36-31(34)30(38-39(6,7)32(3,4)5)22-24-16-18-25(19-17-24)35-21-20-33-26-12-8-10-14-28(26)37-29-15-11-9-13-27(29)33/h8-19,23,30H,20-22H2,1-7H3 |
| InChIKey | GWBNVTUHBNZXHZ-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.75 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_666_B(3)', 'substructure': 'N/A'} |
|---|