C29H24NO5- — CID 18172360
3-[4-(2-phenoxazin-10-ylethoxy)phenyl]-2-phenoxypropanoate (PubChem CID 18172360) has the molecular formula C29H24NO5- and a molecular weight of 466.51 g/mol. Its IUPAC name is 3-[4-(2-phenoxazin-10-ylethoxy)phenyl]-2-phenoxypropanoate.
| Compound Name | 3-[4-(2-phenoxazin-10-ylethoxy)phenyl]-2-phenoxypropanoate |
|---|---|
| PubChem CID | 18172360 |
| Molecular Formula | C29H24NO5- |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 3-[4-(2-phenoxazin-10-ylethoxy)phenyl]-2-phenoxypropanoate |
| SMILES | O=C([O-])C(Cc1ccc(OCCN2c3ccccc3Oc3ccccc32)cc1)Oc1ccccc1 |
| InChI | InChI=1S/C29H25NO5/c31-29(32)28(34-23-8-2-1-3-9-23)20-21-14-16-22(17-15-21)33-19-18-30-24-10-4-6-12-26(24)35-27-13-7-5-11-25(27)30/h1-17,28H,18-20H2,(H,31,32)/p-1 |
| InChIKey | VAGWNGSZQAQBFP-UHFFFAOYSA-M |
| XLogP | 4.75 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_666_B(3)', 'substructure': 'N/A'} |
|---|