C26H26O4S — CID 23445762
2-ethoxy-3-[4-[2-(9H-thioxanthen-9-yl)ethoxy]phenyl]propanoic acid (PubChem CID 23445762) has the molecular formula C26H26O4S and a molecular weight of 434.56 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-(9H-thioxanthen-9-yl)ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-(9H-thioxanthen-9-yl)ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 23445762 |
| Molecular Formula | C26H26O4S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 2-ethoxy-3-[4-[2-(9H-thioxanthen-9-yl)ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCC2c3ccccc3Sc3ccccc32)cc1)C(=O)O |
| InChI | InChI=1S/C26H26O4S/c1-2-29-23(26(27)28)17-18-11-13-19(14-12-18)30-16-15-20-21-7-3-5-9-24(21)31-25-10-6-4-8-22(20)25/h3-14,20,23H,2,15-17H2,1H3,(H,27,28) |
| InChIKey | OCIQJMJJNWIDKU-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |