C30H34O4 — CID 57206334
2-[4-[2-(9H-fluoren-9-yl)ethoxy]phenyl]-2-hexoxypropanoic acid (PubChem CID 57206334) has the molecular formula C30H34O4 and a molecular weight of 458.60 g/mol. Its IUPAC name is 2-[4-[2-(9H-fluoren-9-yl)ethoxy]phenyl]-2-hexoxypropanoic acid.
| Compound Name | 2-[4-[2-(9H-fluoren-9-yl)ethoxy]phenyl]-2-hexoxypropanoic acid |
|---|---|
| PubChem CID | 57206334 |
| Molecular Formula | C30H34O4 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | 2-[4-[2-(9H-fluoren-9-yl)ethoxy]phenyl]-2-hexoxypropanoic acid |
| SMILES | CCCCCCOC(C)(C(=O)O)c1ccc(OCCC2c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C30H34O4/c1-3-4-5-10-20-34-30(2,29(31)32)22-15-17-23(18-16-22)33-21-19-28-26-13-8-6-11-24(26)25-12-7-9-14-27(25)28/h6-9,11-18,28H,3-5,10,19-21H2,1-2H3,(H,31,32) |
| InChIKey | PBUZCGHTPPXYPY-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|