C15H19NO3 — CID 107314200
7-(2,2-diethoxyethoxy)quinoline (PubChem CID 107314200) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is 7-(2,2-diethoxyethoxy)quinoline.
| Compound Name | 7-(2,2-diethoxyethoxy)quinoline |
|---|---|
| PubChem CID | 107314200 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 7-(2,2-diethoxyethoxy)quinoline |
| SMILES | CCOC(COc1ccc2cccnc2c1)OCC |
| InChI | InChI=1S/C15H19NO3/c1-3-17-15(18-4-2)11-19-13-8-7-12-6-5-9-16-14(12)10-13/h5-10,15H,3-4,11H2,1-2H3 |
| InChIKey | FJUZYUHSQWEEHB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|