C10H9ClF3NO2 — CID 87336288
N-chloro-4-(1,1,1-trifluoropropan-2-yloxy)benzamide (PubChem CID 87336288) has the molecular formula C10H9ClF3NO2 and a molecular weight of 267.63 g/mol. Its IUPAC name is N-chloro-4-(1,1,1-trifluoropropan-2-yloxy)benzamide.
| Compound Name | N-chloro-4-(1,1,1-trifluoropropan-2-yloxy)benzamide |
|---|---|
| PubChem CID | 87336288 |
| Molecular Formula | C10H9ClF3NO2 |
| Molecular Weight | 267.63 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | N-chloro-4-(1,1,1-trifluoropropan-2-yloxy)benzamide |
| SMILES | CC(Oc1ccc(C(=O)NCl)cc1)C(F)(F)F |
| InChI | InChI=1S/C10H9ClF3NO2/c1-6(10(12,13)14)17-8-4-2-7(3-5-8)9(16)15-11/h2-6H,1H3,(H,15,16) |
| InChIKey | BDOGZVCBBWSNEI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.63 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|