C15H21N3O5S — CID 108574942
N-[2-[(4-acetamidophenyl)sulfonylamino]ethyl]-4-oxopentanamide (PubChem CID 108574942) has the molecular formula C15H21N3O5S and a molecular weight of 355.42 g/mol. Its IUPAC name is N-[2-[(4-acetamidophenyl)sulfonylamino]ethyl]-4-oxopentanamide.
| Compound Name | N-[2-[(4-acetamidophenyl)sulfonylamino]ethyl]-4-oxopentanamide |
|---|---|
| PubChem CID | 108574942 |
| Molecular Formula | C15H21N3O5S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | N-[2-[(4-acetamidophenyl)sulfonylamino]ethyl]-4-oxopentanamide |
| SMILES | CC(=O)CCC(=O)NCCNS(=O)(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C15H21N3O5S/c1-11(19)3-8-15(21)16-9-10-17-24(22,23)14-6-4-13(5-7-14)18-12(2)20/h4-7,17H,3,8-10H2,1-2H3,(H,16,21)(H,18,20) |
| InChIKey | FMYQTDNKIUNFDM-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|