C21H26N2O5S — CID 7839568
[2-[4-[(2S)-butan-2-yl]anilino]-2-oxoethyl] 2-[(4-methylphenyl)sulfonylamino]acetate (PubChem CID 7839568) has the molecular formula C21H26N2O5S and a molecular weight of 418.52 g/mol. Its IUPAC name is [2-[4-[(2S)-butan-2-yl]anilino]-2-oxoethyl] 2-[(4-methylphenyl)sulfonylamino]acetate.
| Compound Name | [2-[4-[(2S)-butan-2-yl]anilino]-2-oxoethyl] 2-[(4-methylphenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 7839568 |
| Molecular Formula | C21H26N2O5S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | [2-[4-[(2S)-butan-2-yl]anilino]-2-oxoethyl] 2-[(4-methylphenyl)sulfonylamino]acetate |
| SMILES | CC[C@H](C)c1ccc(NC(=O)COC(=O)CNS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H26N2O5S/c1-4-16(3)17-7-9-18(10-8-17)23-20(24)14-28-21(25)13-22-29(26,27)19-11-5-15(2)6-12-19/h5-12,16,22H,4,13-14H2,1-3H3,(H,23,24)/t16-/m0/s1 |
| InChIKey | NERVINLQKPDHMD-INIZCTEOSA-N |
| XLogP | 2.97 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |