C19H22N4O4S — CID 9038855
2-(benzenesulfonamido)-N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]acetamide (PubChem CID 9038855) has the molecular formula C19H22N4O4S and a molecular weight of 402.48 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]acetamide.
| Compound Name | 2-(benzenesulfonamido)-N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 9038855 |
| Molecular Formula | C19H22N4O4S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 2-(benzenesulfonamido)-N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]acetamide |
| SMILES | O=C(CNS(=O)(=O)c1ccccc1)N/N=C\c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C19H22N4O4S/c24-19(15-21-28(25,26)18-4-2-1-3-5-18)22-20-14-16-6-8-17(9-7-16)23-10-12-27-13-11-23/h1-9,14,21H,10-13,15H2,(H,22,24)/b20-14- |
| InChIKey | FTNATGJLNAONBQ-ZHZULCJRSA-N |
| XLogP | 0.95 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|