C18H19N3O6S — CID 9237986
2-(benzenesulfonamido)-N-[(Z)-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)methylideneamino]acetamide (PubChem CID 9237986) has the molecular formula C18H19N3O6S and a molecular weight of 405.43 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-N-[(Z)-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)methylideneamino]acetamide.
| Compound Name | 2-(benzenesulfonamido)-N-[(Z)-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 9237986 |
| Molecular Formula | C18H19N3O6S |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 2-(benzenesulfonamido)-N-[(Z)-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)methylideneamino]acetamide |
| SMILES | COc1cc(/C=N\NC(=O)CNS(=O)(=O)c2ccccc2)cc2c1OCCO2 |
| InChI | InChI=1S/C18H19N3O6S/c1-25-15-9-13(10-16-18(15)27-8-7-26-16)11-19-21-17(22)12-20-28(23,24)14-5-3-2-4-6-14/h2-6,9-11,20H,7-8,12H2,1H3,(H,21,22)/b19-11- |
| InChIKey | BRFRUDJRYYMNTA-ODLFYWEKSA-N |
| XLogP | 0.89 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|