C16H16BrN3O4S — CID 92534259
2-(benzenesulfonamido)-N-[(Z)-(5-bromo-2-methoxyphenyl)methylideneamino]acetamide (PubChem CID 92534259) has the molecular formula C16H16BrN3O4S and a molecular weight of 426.29 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-N-[(Z)-(5-bromo-2-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(benzenesulfonamido)-N-[(Z)-(5-bromo-2-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 92534259 |
| Molecular Formula | C16H16BrN3O4S |
| Molecular Weight | 426.29 g/mol |
| Exact Mass | 425.00 |
| IUPAC Name | 2-(benzenesulfonamido)-N-[(Z)-(5-bromo-2-methoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(Br)cc1/C=N\NC(=O)CNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H16BrN3O4S/c1-24-15-8-7-13(17)9-12(15)10-18-20-16(21)11-19-25(22,23)14-5-3-2-4-6-14/h2-10,19H,11H2,1H3,(H,20,21)/b18-10- |
| InChIKey | LBWXODGEJXISHR-ZDLGFXPLSA-N |
| XLogP | 1.89 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|