C20H30BrN3O3 — CID 6142119
N-[2-[(2Z)-2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]decanamide (PubChem CID 6142119) has the molecular formula C20H30BrN3O3 and a molecular weight of 440.38 g/mol. Its IUPAC name is N-[2-[(2Z)-2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]decanamide.
| Compound Name | N-[2-[(2Z)-2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]decanamide |
|---|---|
| PubChem CID | 6142119 |
| Molecular Formula | C20H30BrN3O3 |
| Molecular Weight | 440.38 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | N-[2-[(2Z)-2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]decanamide |
| SMILES | CCCCCCCCCC(=O)NCC(=O)N/N=C\c1cc(Br)ccc1OC |
| InChI | InChI=1S/C20H30BrN3O3/c1-3-4-5-6-7-8-9-10-19(25)22-15-20(26)24-23-14-16-13-17(21)11-12-18(16)27-2/h11-14H,3-10,15H2,1-2H3,(H,22,25)(H,24,26)/b23-14- |
| InChIKey | MKQDXUXONZRGIE-UCQKPKSFSA-N |
| XLogP | 4.16 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|