C21H23N5O2S — CID 9462786
3-ethyl-4-oxo-N-[(Z)-(5-piperidin-1-ylthiophen-2-yl)methylideneamino]phthalazine-1-carboxamide (PubChem CID 9462786) has the molecular formula C21H23N5O2S and a molecular weight of 409.52 g/mol. Its IUPAC name is 3-ethyl-4-oxo-N-[(Z)-(5-piperidin-1-ylthiophen-2-yl)methylideneamino]phthalazine-1-carboxamide.
| Compound Name | 3-ethyl-4-oxo-N-[(Z)-(5-piperidin-1-ylthiophen-2-yl)methylideneamino]phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 9462786 |
| Molecular Formula | C21H23N5O2S |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 3-ethyl-4-oxo-N-[(Z)-(5-piperidin-1-ylthiophen-2-yl)methylideneamino]phthalazine-1-carboxamide |
| SMILES | CCn1nc(C(=O)N/N=C\c2ccc(N3CCCCC3)s2)c2ccccc2c1=O |
| InChI | InChI=1S/C21H23N5O2S/c1-2-26-21(28)17-9-5-4-8-16(17)19(24-26)20(27)23-22-14-15-10-11-18(29-15)25-12-6-3-7-13-25/h4-5,8-11,14H,2-3,6-7,12-13H2,1H3,(H,23,27)/b22-14- |
| InChIKey | SGGMLTLCFOCAQM-HMAPJEAMSA-N |
| XLogP | 3.23 |
| TPSA | 79.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|