C18H20N6OS — CID 8975880
2-(benzotriazol-1-yl)-N-[(Z)-(5-piperidin-1-ylthiophen-2-yl)methylideneamino]acetamide (PubChem CID 8975880) has the molecular formula C18H20N6OS and a molecular weight of 368.47 g/mol. Its IUPAC name is 2-(benzotriazol-1-yl)-N-[(Z)-(5-piperidin-1-ylthiophen-2-yl)methylideneamino]acetamide.
| Compound Name | 2-(benzotriazol-1-yl)-N-[(Z)-(5-piperidin-1-ylthiophen-2-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 8975880 |
| Molecular Formula | C18H20N6OS |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 2-(benzotriazol-1-yl)-N-[(Z)-(5-piperidin-1-ylthiophen-2-yl)methylideneamino]acetamide |
| SMILES | O=C(Cn1nnc2ccccc21)N/N=C\c1ccc(N2CCCCC2)s1 |
| InChI | InChI=1S/C18H20N6OS/c25-17(13-24-16-7-3-2-6-15(16)20-22-24)21-19-12-14-8-9-18(26-14)23-10-4-1-5-11-23/h2-3,6-9,12H,1,4-5,10-11,13H2,(H,21,25)/b19-12- |
| InChIKey | UOESTIAIISBALH-UNOMPAQXSA-N |
| XLogP | 2.63 |
| TPSA | 75.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|