C17H17N7O2S — CID 46804690
N-[(E)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]-4-(tetrazol-1-yl)benzamide (PubChem CID 46804690) has the molecular formula C17H17N7O2S and a molecular weight of 383.44 g/mol. Its IUPAC name is N-[(E)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]-4-(tetrazol-1-yl)benzamide.
| Compound Name | N-[(E)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]-4-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 46804690 |
| Molecular Formula | C17H17N7O2S |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | N-[(E)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]-4-(tetrazol-1-yl)benzamide |
| SMILES | O=C(N/N=C/c1ccc(N2CCOCC2)s1)c1ccc(-n2cnnn2)cc1 |
| InChI | InChI=1S/C17H17N7O2S/c25-17(13-1-3-14(4-2-13)24-12-19-21-22-24)20-18-11-15-5-6-16(27-15)23-7-9-26-10-8-23/h1-6,11-12H,7-10H2,(H,20,25)/b18-11+ |
| InChIKey | QTGJBFUGTFEJHU-WOJGMQOQSA-N |
| XLogP | 1.32 |
| TPSA | 97.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|