C17H14N6O3 — CID 42998177
methyl 4-[(E)-[[4-(tetrazol-1-yl)benzoyl]hydrazinylidene]methyl]benzoate (PubChem CID 42998177) has the molecular formula C17H14N6O3 and a molecular weight of 350.34 g/mol. Its IUPAC name is methyl 4-[(E)-[[4-(tetrazol-1-yl)benzoyl]hydrazinylidene]methyl]benzoate.
| Compound Name | methyl 4-[(E)-[[4-(tetrazol-1-yl)benzoyl]hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 42998177 |
| Molecular Formula | C17H14N6O3 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | methyl 4-[(E)-[[4-(tetrazol-1-yl)benzoyl]hydrazinylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=N/NC(=O)c2ccc(-n3cnnn3)cc2)cc1 |
| InChI | InChI=1S/C17H14N6O3/c1-26-17(25)14-4-2-12(3-5-14)10-18-20-16(24)13-6-8-15(9-7-13)23-11-19-21-22-23/h2-11H,1H3,(H,20,24)/b18-10+ |
| InChIKey | CEYCBYMNPGKLBX-VCHYOVAHSA-N |
| XLogP | 1.21 |
| TPSA | 111.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|