C20H22N6O3 — CID 42998205
N-[(E)-(4-butoxy-3-methoxyphenyl)methylideneamino]-4-(tetrazol-1-yl)benzamide (PubChem CID 42998205) has the molecular formula C20H22N6O3 and a molecular weight of 394.44 g/mol. Its IUPAC name is N-[(E)-(4-butoxy-3-methoxyphenyl)methylideneamino]-4-(tetrazol-1-yl)benzamide.
| Compound Name | N-[(E)-(4-butoxy-3-methoxyphenyl)methylideneamino]-4-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 42998205 |
| Molecular Formula | C20H22N6O3 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | N-[(E)-(4-butoxy-3-methoxyphenyl)methylideneamino]-4-(tetrazol-1-yl)benzamide |
| SMILES | CCCCOc1ccc(/C=N/NC(=O)c2ccc(-n3cnnn3)cc2)cc1OC |
| InChI | InChI=1S/C20H22N6O3/c1-3-4-11-29-18-10-5-15(12-19(18)28-2)13-21-23-20(27)16-6-8-17(9-7-16)26-14-22-24-25-26/h5-10,12-14H,3-4,11H2,1-2H3,(H,23,27)/b21-13+ |
| InChIKey | POVXAOHOLYBAOX-FYJGNVAPSA-N |
| XLogP | 2.61 |
| TPSA | 103.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|