C15H10F2N6O — CID 42999207
N-[(E)-(3,4-difluorophenyl)methylideneamino]-4-(tetrazol-1-yl)benzamide (PubChem CID 42999207) has the molecular formula C15H10F2N6O and a molecular weight of 328.28 g/mol. Its IUPAC name is N-[(E)-(3,4-difluorophenyl)methylideneamino]-4-(tetrazol-1-yl)benzamide.
| Compound Name | N-[(E)-(3,4-difluorophenyl)methylideneamino]-4-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 42999207 |
| Molecular Formula | C15H10F2N6O |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | N-[(E)-(3,4-difluorophenyl)methylideneamino]-4-(tetrazol-1-yl)benzamide |
| SMILES | O=C(N/N=C/c1ccc(F)c(F)c1)c1ccc(-n2cnnn2)cc1 |
| InChI | InChI=1S/C15H10F2N6O/c16-13-6-1-10(7-14(13)17)8-18-20-15(24)11-2-4-12(5-3-11)23-9-19-21-22-23/h1-9H,(H,20,24)/b18-8+ |
| InChIKey | GKYSCAGORNHZIK-QGMBQPNBSA-N |
| XLogP | 1.70 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|