C17H18ClN3O2S2 — CID 9121609
2-(4-chlorophenyl)sulfanyl-N-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]acetamide (PubChem CID 9121609) has the molecular formula C17H18ClN3O2S2 and a molecular weight of 395.94 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 9121609 |
| Molecular Formula | C17H18ClN3O2S2 |
| Molecular Weight | 395.94 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]acetamide |
| SMILES | O=C(CSc1ccc(Cl)cc1)N/N=C\c1ccc(N2CCOCC2)s1 |
| InChI | InChI=1S/C17H18ClN3O2S2/c18-13-1-3-14(4-2-13)24-12-16(22)20-19-11-15-5-6-17(25-15)21-7-9-23-10-8-21/h1-6,11H,7-10,12H2,(H,20,22)/b19-11- |
| InChIKey | QTXAOGONAMYVNH-ODLFYWEKSA-N |
| XLogP | 3.48 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.94 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|