C25H24N6O2S2 — CID 16556147
2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(E)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]acetamide (PubChem CID 16556147) has the molecular formula C25H24N6O2S2 and a molecular weight of 504.64 g/mol. Its IUPAC name is 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(E)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]acetamide.
| Compound Name | 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(E)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 16556147 |
| Molecular Formula | C25H24N6O2S2 |
| Molecular Weight | 504.64 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(E)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]acetamide |
| SMILES | O=C(CSc1nnc(-c2ccccc2)n1-c1ccccc1)N/N=C/c1ccc(N2CCOCC2)s1 |
| InChI | InChI=1S/C25H24N6O2S2/c32-22(27-26-17-21-11-12-23(35-21)30-13-15-33-16-14-30)18-34-25-29-28-24(19-7-3-1-4-8-19)31(25)20-9-5-2-6-10-20/h1-12,17H,13-16,18H2,(H,27,32)/b26-17+ |
| InChIKey | GPOPOEZOTSJFIS-YZSQISJMSA-N |
| XLogP | 4.07 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.64 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|