C24H18N6OS — CID 4211557
N-[(4-cyanophenyl)methylideneamino]-2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 4211557) has the molecular formula C24H18N6OS and a molecular weight of 438.52 g/mol. Its IUPAC name is N-[(4-cyanophenyl)methylideneamino]-2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-[(4-cyanophenyl)methylideneamino]-2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 4211557 |
| Molecular Formula | C24H18N6OS |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | N-[(4-cyanophenyl)methylideneamino]-2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | N#Cc1ccc(C=NNC(=O)CSc2nnc(-c3ccccc3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H18N6OS/c25-15-18-11-13-19(14-12-18)16-26-27-22(31)17-32-24-29-28-23(20-7-3-1-4-8-20)30(24)21-9-5-2-6-10-21/h1-14,16H,17H2,(H,27,31) |
| InChIKey | LXPUHXMJRRMYKB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 95.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|