C25H24N6O2S — CID 2540246
N-(4-morpholin-4-ylphenyl)-2-[(4-phenyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 2540246) has the molecular formula C25H24N6O2S and a molecular weight of 472.57 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-2-[(4-phenyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-(4-morpholin-4-ylphenyl)-2-[(4-phenyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 2540246 |
| Molecular Formula | C25H24N6O2S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-2-[(4-phenyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nnc(-c2cccnc2)n1-c1ccccc1)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C25H24N6O2S/c32-23(27-20-8-10-21(11-9-20)30-13-15-33-16-14-30)18-34-25-29-28-24(19-5-4-12-26-17-19)31(25)22-6-2-1-3-7-22/h1-12,17H,13-16,18H2,(H,27,32) |
| InChIKey | RDLKXYCSPHIARJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|