C27H29N7OS — CID 24635310
N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-2-[(4-phenyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 24635310) has the molecular formula C27H29N7OS and a molecular weight of 499.64 g/mol. Its IUPAC name is N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-2-[(4-phenyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-2-[(4-phenyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 24635310 |
| Molecular Formula | C27H29N7OS |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-2-[(4-phenyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | Cc1cc(N2CCN(C)CC2)ccc1NC(=O)CSc1nnc(-c2cccnc2)n1-c1ccccc1 |
| InChI | InChI=1S/C27H29N7OS/c1-20-17-23(33-15-13-32(2)14-16-33)10-11-24(20)29-25(35)19-36-27-31-30-26(21-7-6-12-28-18-21)34(27)22-8-4-3-5-9-22/h3-12,17-18H,13-16,19H2,1-2H3,(H,29,35) |
| InChIKey | OXLOJQHCTRUTKI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|