C25H28N6O — CID 78832409
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[(1,3-diphenylpyrazol-4-yl)methyl]urea (PubChem CID 78832409) has the molecular formula C25H28N6O and a molecular weight of 428.54 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[(1,3-diphenylpyrazol-4-yl)methyl]urea.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[(1,3-diphenylpyrazol-4-yl)methyl]urea |
|---|---|
| PubChem CID | 78832409 |
| Molecular Formula | C25H28N6O |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[(1,3-diphenylpyrazol-4-yl)methyl]urea |
| SMILES | Cc1cc(C)n(CCCNC(=O)NCc2cn(-c3ccccc3)nc2-c2ccccc2)n1 |
| InChI | InChI=1S/C25H28N6O/c1-19-16-20(2)30(28-19)15-9-14-26-25(32)27-17-22-18-31(23-12-7-4-8-13-23)29-24(22)21-10-5-3-6-11-21/h3-8,10-13,16,18H,9,14-15,17H2,1-2H3,(H2,26,27,32) |
| InChIKey | MSJFVHSWOXKIPS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 76.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|